C19H16BrN3S — CID 23903215
4-(3-bromophenyl)-3-(2,3-dihydroinden-1-ylideneamino)-N-methyl-1,3-thiazol-2-imine (PubChem CID 23903215) has the molecular formula C19H16BrN3S and a molecular weight of 398.33 g/mol. Its IUPAC name is 4-(3-bromophenyl)-3-(2,3-dihydroinden-1-ylideneamino)-N-methyl-1,3-thiazol-2-imine.
| Compound Name | 4-(3-bromophenyl)-3-(2,3-dihydroinden-1-ylideneamino)-N-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23903215 |
| Molecular Formula | C19H16BrN3S |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 4-(3-bromophenyl)-3-(2,3-dihydroinden-1-ylideneamino)-N-methyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2cccc(Br)c2)n1N=C1CCc2ccccc21 |
| InChI | InChI=1S/C19H16BrN3S/c1-21-19-23(18(12-24-19)14-6-4-7-15(20)11-14)22-17-10-9-13-5-2-3-8-16(13)17/h2-8,11-12H,9-10H2,1H3/b21-19-,22-17? |
| InChIKey | OBTDQPDKKLUOPN-AFGRJXEYSA-N |
| XLogP | 4.71 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|