C26H38N4O5S — CID 23834876
(3S,6R,7S,8aS)-6-(4-hydroxyphenyl)-3-(2-methylpropyl)-1,4-dioxo-N-[6-[(2-sulfanylacetyl)amino]hexyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 23834876) has the molecular formula C26H38N4O5S and a molecular weight of 518.68 g/mol. Its IUPAC name is (3S,6R,7S,8aS)-6-(4-hydroxyphenyl)-3-(2-methylpropyl)-1,4-dioxo-N-[6-[(2-sulfanylacetyl)amino]hexyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (3S,6R,7S,8aS)-6-(4-hydroxyphenyl)-3-(2-methylpropyl)-1,4-dioxo-N-[6-[(2-sulfanylacetyl)amino]hexyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23834876 |
| Molecular Formula | C26H38N4O5S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | (3S,6R,7S,8aS)-6-(4-hydroxyphenyl)-3-(2-methylpropyl)-1,4-dioxo-N-[6-[(2-sulfanylacetyl)amino]hexyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H]2C[C@H](C(=O)NCCCCCCNC(=O)CS)[C@H](c3ccc(O)cc3)N2C1=O |
| InChI | InChI=1S/C26H38N4O5S/c1-16(2)13-20-26(35)30-21(25(34)29-20)14-19(23(30)17-7-9-18(31)10-8-17)24(33)28-12-6-4-3-5-11-27-22(32)15-36/h7-10,16,19-21,23,31,36H,3-6,11-15H2,1-2H3,(H,27,32)(H,28,33)(H,29,34)/t19-,20-,21-,23-/m0/s1 |
| InChIKey | TYHUNUBDCQKJAE-FKEBYFGASA-N |
| XLogP | 1.92 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|