C25H34N4O5S — CID 23777030
(3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-N-[6-[(2-sulfanylacetyl)amino]hexyl]-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide (PubChem CID 23777030) has the molecular formula C25H34N4O5S and a molecular weight of 502.64 g/mol. Its IUPAC name is (3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-N-[6-[(2-sulfanylacetyl)amino]hexyl]-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide.
| Compound Name | (3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-N-[6-[(2-sulfanylacetyl)amino]hexyl]-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide |
|---|---|
| PubChem CID | 23777030 |
| Molecular Formula | C25H34N4O5S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | (3S,5S,6R,9S)-6-(4-hydroxyphenyl)-2,8-dioxo-N-[6-[(2-sulfanylacetyl)amino]hexyl]-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide |
| SMILES | O=C(CS)NCCCCCCNC(=O)[C@H]1C[C@H]2C(=O)N3CCC[C@H]3C(=O)N2[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C25H34N4O5S/c30-17-9-7-16(8-10-17)22-18(23(32)27-12-4-2-1-3-11-26-21(31)15-35)14-20-24(33)28-13-5-6-19(28)25(34)29(20)22/h7-10,18-20,22,30,35H,1-6,11-15H2,(H,26,31)(H,27,32)/t18-,19-,20-,22-/m0/s1 |
| InChIKey | YOSDGPBVOFFFRM-XWUOBKMESA-N |
| XLogP | 1.38 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|