C27H44N5O4+ — CID 23975059
4-[(3S,6S,7R,8aR)-7-(6-aminohexylcarbamoyl)-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]butyl-trimethylazanium (PubChem CID 23975059) has the molecular formula C27H44N5O4+ and a molecular weight of 502.68 g/mol. Its IUPAC name is 4-[(3S,6S,7R,8aR)-7-(6-aminohexylcarbamoyl)-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]butyl-trimethylazanium.
| Compound Name | 4-[(3S,6S,7R,8aR)-7-(6-aminohexylcarbamoyl)-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]butyl-trimethylazanium |
|---|---|
| PubChem CID | 23975059 |
| Molecular Formula | C27H44N5O4+ |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 4-[(3S,6S,7R,8aR)-7-(6-aminohexylcarbamoyl)-6-(4-hydroxyphenyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]butyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCC[C@@H]1NC(=O)[C@H]2C[C@@H](C(=O)NCCCCCCN)[C@@H](c3ccc(O)cc3)N2C1=O |
| InChI | InChI=1S/C27H43N5O4/c1-32(2,3)17-9-6-10-22-27(36)31-23(26(35)30-22)18-21(24(31)19-11-13-20(33)14-12-19)25(34)29-16-8-5-4-7-15-28/h11-14,21-24H,4-10,15-18,28H2,1-3H3,(H2-,29,30,33,34,35)/p+1/t21-,22+,23-,24-/m1/s1 |
| InChIKey | DIUZMYKXCQIRTE-UEQSERJNSA-O |
| XLogP | 1.66 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|