C30H38N4O6S — CID 23806678
(3S,6S,7R,8aR)-3-benzyl-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-N-[5-[(2-sulfanylacetyl)amino]pentyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 23806678) has the molecular formula C30H38N4O6S and a molecular weight of 582.72 g/mol. Its IUPAC name is (3S,6S,7R,8aR)-3-benzyl-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-N-[5-[(2-sulfanylacetyl)amino]pentyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (3S,6S,7R,8aR)-3-benzyl-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-N-[5-[(2-sulfanylacetyl)amino]pentyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23806678 |
| Molecular Formula | C30H38N4O6S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | (3S,6S,7R,8aR)-3-benzyl-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-N-[5-[(2-sulfanylacetyl)amino]pentyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | O=C(CS)NCCCCCNC(=O)[C@@H]1C[C@@H]2C(=O)N[C@@H](Cc3ccccc3)C(=O)N2[C@@H]1c1cccc(OCCO)c1 |
| InChI | InChI=1S/C30H38N4O6S/c35-14-15-40-22-11-7-10-21(17-22)27-23(28(37)32-13-6-2-5-12-31-26(36)19-41)18-25-29(38)33-24(30(39)34(25)27)16-20-8-3-1-4-9-20/h1,3-4,7-11,17,23-25,27,35,41H,2,5-6,12-16,18-19H2,(H,31,36)(H,32,37)(H,33,38)/t23-,24+,25-,27-/m1/s1 |
| InChIKey | OJBZBQUANNOWJV-SPGPFUFCSA-N |
| XLogP | 1.39 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|