C25H36N4O5 — CID 24868970
(3R,5R,6S,9S)-N-[4-(dimethylamino)butyl]-6-[3-(2-hydroxyethoxy)phenyl]-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide (PubChem CID 24868970) has the molecular formula C25H36N4O5 and a molecular weight of 472.59 g/mol. Its IUPAC name is (3R,5R,6S,9S)-N-[4-(dimethylamino)butyl]-6-[3-(2-hydroxyethoxy)phenyl]-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide.
| Compound Name | (3R,5R,6S,9S)-N-[4-(dimethylamino)butyl]-6-[3-(2-hydroxyethoxy)phenyl]-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide |
|---|---|
| PubChem CID | 24868970 |
| Molecular Formula | C25H36N4O5 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | (3R,5R,6S,9S)-N-[4-(dimethylamino)butyl]-6-[3-(2-hydroxyethoxy)phenyl]-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecane-5-carboxamide |
| SMILES | CN(C)CCCCNC(=O)[C@@H]1C[C@@H]2C(=O)N3CCC[C@H]3C(=O)N2[C@@H]1c1cccc(OCCO)c1 |
| InChI | InChI=1S/C25H36N4O5/c1-27(2)11-4-3-10-26-23(31)19-16-21-24(32)28-12-6-9-20(28)25(33)29(21)22(19)17-7-5-8-18(15-17)34-14-13-30/h5,7-8,15,19-22,30H,3-4,6,9-14,16H2,1-2H3,(H,26,31)/t19-,20+,21-,22-/m1/s1 |
| InChIKey | KKBFQXBONARLBD-CIAFKFPVSA-N |
| XLogP | 0.78 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|