C26H41N5O5 — CID 23919074
(3S,6S,7R,8aR)-3-(4-aminobutyl)-N-(6-aminohexyl)-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 23919074) has the molecular formula C26H41N5O5 and a molecular weight of 503.64 g/mol. Its IUPAC name is (3S,6S,7R,8aR)-3-(4-aminobutyl)-N-(6-aminohexyl)-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (3S,6S,7R,8aR)-3-(4-aminobutyl)-N-(6-aminohexyl)-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23919074 |
| Molecular Formula | C26H41N5O5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | (3S,6S,7R,8aR)-3-(4-aminobutyl)-N-(6-aminohexyl)-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | NCCCCCCNC(=O)[C@@H]1C[C@@H]2C(=O)N[C@@H](CCCCN)C(=O)N2[C@@H]1c1cccc(OCCO)c1 |
| InChI | InChI=1S/C26H41N5O5/c27-11-4-1-2-6-13-29-24(33)20-17-22-25(34)30-21(10-3-5-12-28)26(35)31(22)23(20)18-8-7-9-19(16-18)36-15-14-32/h7-9,16,20-23,32H,1-6,10-15,17,27-28H2,(H,29,33)(H,30,34)/t20-,21+,22-,23-/m1/s1 |
| InChIKey | SRKJANGPZVKZOJ-KAOXLYBCSA-N |
| XLogP | 0.58 |
| TPSA | 160.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|