C20H15Cl2N3O6S — CID 2391068
3-[(2,5-dichlorophenyl)sulfamoyl]-N-[(2,3,4-trihydroxyphenyl)methylideneamino]benzamide (PubChem CID 2391068) has the molecular formula C20H15Cl2N3O6S and a molecular weight of 496.33 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)sulfamoyl]-N-[(2,3,4-trihydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-[(2,5-dichlorophenyl)sulfamoyl]-N-[(2,3,4-trihydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2391068 |
| Molecular Formula | C20H15Cl2N3O6S |
| Molecular Weight | 496.33 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)sulfamoyl]-N-[(2,3,4-trihydroxyphenyl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccc(O)c(O)c1O)c1cccc(S(=O)(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C20H15Cl2N3O6S/c21-13-5-6-15(22)16(9-13)25-32(30,31)14-3-1-2-11(8-14)20(29)24-23-10-12-4-7-17(26)19(28)18(12)27/h1-10,25-28H,(H,24,29) |
| InChIKey | NDCJOXMXGFZONC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 148.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|