C19H20F2N2O2S — CID 24504561
2,4-difluoro-N-[4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxobutyl]benzamide (PubChem CID 24504561) has the molecular formula C19H20F2N2O2S and a molecular weight of 378.44 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 24504561 |
| Molecular Formula | C19H20F2N2O2S |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2,4-difluoro-N-[4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-oxobutyl]benzamide |
| SMILES | CC1c2ccsc2CCN1C(=O)CCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H20F2N2O2S/c1-12-14-7-10-26-17(14)6-9-23(12)18(24)3-2-8-22-19(25)15-5-4-13(20)11-16(15)21/h4-5,7,10-12H,2-3,6,8-9H2,1H3,(H,22,25) |
| InChIKey | SSGSKHCFYZVCHY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|