C22H27N7O2S2 — CID 24550874
3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]propanamide (PubChem CID 24550874) has the molecular formula C22H27N7O2S2 and a molecular weight of 485.64 g/mol. Its IUPAC name is 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]propanamide.
| Compound Name | 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]propanamide |
|---|---|
| PubChem CID | 24550874 |
| Molecular Formula | C22H27N7O2S2 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)pentyl]propanamide |
| SMILES | CSc1nc2nc(C)c(CCC(=O)NCCCCCc3nc(-c4cccs4)no3)c(C)n2n1 |
| InChI | InChI=1S/C22H27N7O2S2/c1-14-16(15(2)29-21(24-14)26-22(27-29)32-3)10-11-18(30)23-12-6-4-5-9-19-25-20(28-31-19)17-8-7-13-33-17/h7-8,13H,4-6,9-12H2,1-3H3,(H,23,30) |
| InChIKey | DZBPAJDFROILGD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|