C16H11ClN2O3S — CID 24674847
(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 24674847) has the molecular formula C16H11ClN2O3S and a molecular weight of 346.80 g/mol. Its IUPAC name is (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 24674847 |
| Molecular Formula | C16H11ClN2O3S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | (5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methyl (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)OCc1noc(-c2ccsc2)n1 |
| InChI | InChI=1S/C16H11ClN2O3S/c17-13-3-1-2-11(8-13)4-5-15(20)21-9-14-18-16(22-19-14)12-6-7-23-10-12/h1-8,10H,9H2/b5-4+ |
| InChIKey | WPJLTQLDFCIHSL-SNAWJCMRSA-N |
| XLogP | 4.21 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|