C13H16O4S — CID 24775596
[(2E)-2-[(4-methoxyphenyl)methylidene]cyclopropyl]methyl methanesulfonate (PubChem CID 24775596) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is [(2E)-2-[(4-methoxyphenyl)methylidene]cyclopropyl]methyl methanesulfonate.
| Compound Name | [(2E)-2-[(4-methoxyphenyl)methylidene]cyclopropyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 24775596 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | [(2E)-2-[(4-methoxyphenyl)methylidene]cyclopropyl]methyl methanesulfonate |
| SMILES | COc1ccc(/C=C2/CC2COS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H16O4S/c1-16-13-5-3-10(4-6-13)7-11-8-12(11)9-17-18(2,14)15/h3-7,12H,8-9H2,1-2H3/b11-7- |
| InChIKey | IIHIXBXPWMTDAH-XFFZJAGNSA-N |
| XLogP | 2.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|