C18H17Cl2N3O6S — CID 24786094
5-[2,6-dichloro-4-(2,4-dioxoimidazolidin-1-yl)phenoxy]-2-methoxy-N,N-dimethylbenzenesulfonamide (PubChem CID 24786094) has the molecular formula C18H17Cl2N3O6S and a molecular weight of 474.32 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(2,4-dioxoimidazolidin-1-yl)phenoxy]-2-methoxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 5-[2,6-dichloro-4-(2,4-dioxoimidazolidin-1-yl)phenoxy]-2-methoxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24786094 |
| Molecular Formula | C18H17Cl2N3O6S |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 5-[2,6-dichloro-4-(2,4-dioxoimidazolidin-1-yl)phenoxy]-2-methoxy-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(Oc2c(Cl)cc(N3CC(=O)NC3=O)cc2Cl)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C18H17Cl2N3O6S/c1-22(2)30(26,27)15-8-11(4-5-14(15)28-3)29-17-12(19)6-10(7-13(17)20)23-9-16(24)21-18(23)25/h4-8H,9H2,1-3H3,(H,21,24,25) |
| InChIKey | YHYIIOXBRQUKPN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|