C19H20O6 — CID 24805365
2-[3-(3,4-dimethoxyphenyl)-1-hydroxyprop-2-ynyl]-3,5-dimethoxyphenol (PubChem CID 24805365) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-[3-(3,4-dimethoxyphenyl)-1-hydroxyprop-2-ynyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[3-(3,4-dimethoxyphenyl)-1-hydroxyprop-2-ynyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 24805365 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[3-(3,4-dimethoxyphenyl)-1-hydroxyprop-2-ynyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(C(O)C#Cc2ccc(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C19H20O6/c1-22-13-10-15(21)19(18(11-13)25-4)14(20)7-5-12-6-8-16(23-2)17(9-12)24-3/h6,8-11,14,20-21H,1-4H3 |
| InChIKey | IMHCXJKMWXAMCG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|