C23H24FNO2S — CID 24905364
2-amino-2-[2-[4-[2-fluoro-4-(4-sulfanylphenyl)phenyl]phenyl]ethyl]propane-1,3-diol (PubChem CID 24905364) has the molecular formula C23H24FNO2S and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[2-fluoro-4-(4-sulfanylphenyl)phenyl]phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-[2-fluoro-4-(4-sulfanylphenyl)phenyl]phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 24905364 |
| Molecular Formula | C23H24FNO2S |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-amino-2-[2-[4-[2-fluoro-4-(4-sulfanylphenyl)phenyl]phenyl]ethyl]propane-1,3-diol |
| SMILES | NC(CO)(CO)CCc1ccc(-c2ccc(-c3ccc(S)cc3)cc2F)cc1 |
| InChI | InChI=1S/C23H24FNO2S/c24-22-13-19(17-5-8-20(28)9-6-17)7-10-21(22)18-3-1-16(2-4-18)11-12-23(25,14-26)15-27/h1-10,13,26-28H,11-12,14-15,25H2 |
| InChIKey | PCUFICGHCKVNJL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|