C6H4F7N5 — CID 24975039
6-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 24975039) has the molecular formula C6H4F7N5 and a molecular weight of 279.12 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 24975039 |
| Molecular Formula | C6H4F7N5 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 6-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C6H4F7N5/c7-4(8,5(9,10)6(11,12)13)1-16-2(14)18-3(15)17-1/h(H4,14,15,16,17,18) |
| InChIKey | DDDUQWIMISTGBL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|