About calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate
calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate (PubChem CID 25015255) has the molecular formula C11H21CaNO5
and a molecular weight of 287.37 g/mol. Its IUPAC name is calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate.
Molecular Properties
| Compound Name | calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate |
| PubChem CID | 25015255 |
| Molecular Formula | C11H21CaNO5 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCC(=O)[O-].C[N+](C)(C)CC([O-])CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C7H15NO3.C4H8O2.Ca/c1-8(2,3)5-6(9)4-7(10)11;1-2-3-4(5)6;/h6H,4-5H2,1-3H3,(H,10,11);2-3H2,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | JPSNPZPKJWHMEP-UHFFFAOYSA-L |
| XLogP | -3.28 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate?
The IUPAC name of calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate (CID 25015255) is calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate.
What is the SMILES notation for calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate?
The canonical SMILES for calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate is CCCC(=O)[O-].C[N+](C)(C)CC([O-])CC(=O)[O-].[Ca+2].
What is the InChIKey of calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate?
The InChIKey is JPSNPZPKJWHMEP-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H15NO3.C4H8O2.Ca/c1-8(2,3)5-6(9)4-7(10)11;1-2-3-4(5)6;/h6H,4-5H2,1-3H3,(H,10,11);2-3H2,1H3,(H,5,6);/q;;+2/p-2.
What are the key properties of calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate?
calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate has a molecular weight of 287.37 g/mol, XLogP of -3.28, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;butanoate;3-oxido-4-(trimethylazaniumyl)butanoate is sourced from PubChem (CID 25015255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).