C18H11BrCl3NO4S — CID 25042343
N-(4-bromo-9-oxo-7,8-dihydro-6H-dibenzofuran-2-yl)-2,4,5-trichlorobenzenesulfonamide (PubChem CID 25042343) has the molecular formula C18H11BrCl3NO4S and a molecular weight of 523.62 g/mol. Its IUPAC name is N-(4-bromo-9-oxo-7,8-dihydro-6H-dibenzofuran-2-yl)-2,4,5-trichlorobenzenesulfonamide.
| Compound Name | N-(4-bromo-9-oxo-7,8-dihydro-6H-dibenzofuran-2-yl)-2,4,5-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 25042343 |
| Molecular Formula | C18H11BrCl3NO4S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 520.87 |
| IUPAC Name | N-(4-bromo-9-oxo-7,8-dihydro-6H-dibenzofuran-2-yl)-2,4,5-trichlorobenzenesulfonamide |
| SMILES | O=C1CCCc2oc3c(Br)cc(NS(=O)(=O)c4cc(Cl)c(Cl)cc4Cl)cc3c21 |
| InChI | InChI=1S/C18H11BrCl3NO4S/c19-10-5-8(4-9-17-14(24)2-1-3-15(17)27-18(9)10)23-28(25,26)16-7-12(21)11(20)6-13(16)22/h4-7,23H,1-3H2 |
| InChIKey | SOOUYBYLGQKMFB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|