C30H32N2O4S — CID 25047452
N-[3-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclohexen-1-yl]-4-hydroxyphenyl]-4-methylbenzenesulfonamide (PubChem CID 25047452) has the molecular formula C30H32N2O4S and a molecular weight of 516.66 g/mol. Its IUPAC name is N-[3-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclohexen-1-yl]-4-hydroxyphenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclohexen-1-yl]-4-hydroxyphenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 25047452 |
| Molecular Formula | C30H32N2O4S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | N-[3-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclohexen-1-yl]-4-hydroxyphenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(O)c(C3=C(N4CCOCC4)/C(=C\c4ccccc4)CCC3)c2)cc1 |
| InChI | InChI=1S/C30H32N2O4S/c1-22-10-13-26(14-11-22)37(34,35)31-25-12-15-29(33)28(21-25)27-9-5-8-24(20-23-6-3-2-4-7-23)30(27)32-16-18-36-19-17-32/h2-4,6-7,10-15,20-21,31,33H,5,8-9,16-19H2,1H3/b24-20- |
| InChIKey | UAWNXETUVSCHKH-GFMRDNFCSA-N |
| XLogP | 5.81 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|