C22H36O2Si — CID 25107592
[(4R,5Z,7E)-6-ethyl-4-methyl-8-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]octa-5,7-dien-1-ynyl]-trimethylsilane (PubChem CID 25107592) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is [(4R,5Z,7E)-6-ethyl-4-methyl-8-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]octa-5,7-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(4R,5Z,7E)-6-ethyl-4-methyl-8-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]octa-5,7-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 25107592 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | [(4R,5Z,7E)-6-ethyl-4-methyl-8-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]octa-5,7-dien-1-ynyl]-trimethylsilane |
| SMILES | CCC(=C/[C@H](C)CC#C[Si](C)(C)C)/C=C/[C@H]1CC=C[C@H](OC(C)C)O1 |
| InChI | InChI=1S/C22H36O2Si/c1-8-20(17-19(4)11-10-16-25(5,6)7)14-15-21-12-9-13-22(24-21)23-18(2)3/h9,13-15,17-19,21-22H,8,11-12H2,1-7H3/b15-14+,20-17-/t19-,21-,22-/m1/s1 |
| InChIKey | BGIMUPNIOMDIAH-JYLDUBQOSA-N |
| XLogP | 5.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|