C19H24N6O — CID 25126886
(6S)-8-[(4-aminophenyl)methyl]-13-(ethylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 25126886) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is (6S)-8-[(4-aminophenyl)methyl]-13-(ethylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-8-[(4-aminophenyl)methyl]-13-(ethylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 25126886 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (6S)-8-[(4-aminophenyl)methyl]-13-(ethylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCNc1ncc2c(n1)N1CCC[C@H]1CN(Cc1ccc(N)cc1)C2=O |
| InChI | InChI=1S/C19H24N6O/c1-2-21-19-22-10-16-17(23-19)25-9-3-4-15(25)12-24(18(16)26)11-13-5-7-14(20)8-6-13/h5-8,10,15H,2-4,9,11-12,20H2,1H3,(H,21,22,23)/t15-/m0/s1 |
| InChIKey | NXNMFZMQDZMCCK-HNNXBMFYSA-N |
| XLogP | 2.12 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|