C30H28Cl3NO3 — CID 25170497
2,2,2-trichloro-N-[(2S,3S,6R)-6-prop-2-enyl-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl]acetamide (PubChem CID 25170497) has the molecular formula C30H28Cl3NO3 and a molecular weight of 556.92 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(2S,3S,6R)-6-prop-2-enyl-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(2S,3S,6R)-6-prop-2-enyl-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl]acetamide |
|---|---|
| PubChem CID | 25170497 |
| Molecular Formula | C30H28Cl3NO3 |
| Molecular Weight | 556.92 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 2,2,2-trichloro-N-[(2S,3S,6R)-6-prop-2-enyl-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl]acetamide |
| SMILES | C=CC[C@@H]1C=C[C@H](NC(=O)C(Cl)(Cl)Cl)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C30H28Cl3NO3/c1-2-12-25-19-20-26(34-28(35)30(31,32)33)27(37-25)21-36-29(22-13-6-3-7-14-22,23-15-8-4-9-16-23)24-17-10-5-11-18-24/h2-11,13-20,25-27H,1,12,21H2,(H,34,35)/t25-,26+,27-/m1/s1 |
| InChIKey | BPBVYQPTOJGCDX-KWXIBIRDSA-N |
| XLogP | 6.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.92 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|