C36H20F6Ge — CID 25194402
1,2,4,6,8,9-hexafluoro-3,5,5,7-tetraphenylbenzo[b][1]benzogermole (PubChem CID 25194402) has the molecular formula C36H20F6Ge and a molecular weight of 639.15 g/mol. Its IUPAC name is 1,2,4,6,8,9-hexafluoro-3,5,5,7-tetraphenylbenzo[b][1]benzogermole.
| Compound Name | 1,2,4,6,8,9-hexafluoro-3,5,5,7-tetraphenylbenzo[b][1]benzogermole |
|---|---|
| PubChem CID | 25194402 |
| Molecular Formula | C36H20F6Ge |
| Molecular Weight | 639.15 g/mol |
| Exact Mass | 640.07 |
| IUPAC Name | 1,2,4,6,8,9-hexafluoro-3,5,5,7-tetraphenylbenzo[b][1]benzogermole |
| SMILES | Fc1c(F)c2c(c(F)c1-c1ccccc1)[Ge](c1ccccc1)(c1ccccc1)c1c(F)c(-c3ccccc3)c(F)c(F)c1-2 |
| InChI | InChI=1S/C36H20F6Ge/c37-29-25(21-13-5-1-6-14-21)33(41)35-27(31(29)39)28-32(40)30(38)26(22-15-7-2-8-16-22)34(42)36(28)43(35,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | USPFTSSTMYKCOA-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.15 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|