C25H32F3NO7 — CID 25197344
tert-butyl (Z,2R)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (PubChem CID 25197344) has the molecular formula C25H32F3NO7 and a molecular weight of 515.53 g/mol. Its IUPAC name is tert-butyl (Z,2R)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
| Compound Name | tert-butyl (Z,2R)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
|---|---|
| PubChem CID | 25197344 |
| Molecular Formula | C25H32F3NO7 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | tert-butyl (Z,2R)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](C/C=C\[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H32F3NO7/c1-23(2,3)35-20(30)16(29-22(31)25(26,27)28)12-9-13-17-18(32-14-15-10-7-6-8-11-15)19-21(33-17)36-24(4,5)34-19/h6-11,13,16-19,21H,12,14H2,1-5H3,(H,29,31)/b13-9-/t16-,17-,18+,19-,21-/m1/s1 |
| InChIKey | NOTNYNIXRPMZLX-BNNYWJDFSA-N |
| XLogP | 3.78 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|