C20H22Cl2N4O3 — CID 26072183
3,6-dichloro-N-(2,4-dimorpholin-4-ylphenyl)pyridine-2-carboxamide (PubChem CID 26072183) has the molecular formula C20H22Cl2N4O3 and a molecular weight of 437.33 g/mol. Its IUPAC name is 3,6-dichloro-N-(2,4-dimorpholin-4-ylphenyl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(2,4-dimorpholin-4-ylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 26072183 |
| Molecular Formula | C20H22Cl2N4O3 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 3,6-dichloro-N-(2,4-dimorpholin-4-ylphenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1N1CCOCC1)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H22Cl2N4O3/c21-15-2-4-18(22)24-19(15)20(27)23-16-3-1-14(25-5-9-28-10-6-25)13-17(16)26-7-11-29-12-8-26/h1-4,13H,5-12H2,(H,23,27) |
| InChIKey | VOILCAFCIPAKCU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|