C20H16N2O3S3 — CID 2857235
(4,4-dimethyl-8-nitro-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-(3-methylphenyl)methanone (PubChem CID 2857235) has the molecular formula C20H16N2O3S3 and a molecular weight of 428.56 g/mol. Its IUPAC name is (4,4-dimethyl-8-nitro-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-(3-methylphenyl)methanone.
| Compound Name | (4,4-dimethyl-8-nitro-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 2857235 |
| Molecular Formula | C20H16N2O3S3 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | (4,4-dimethyl-8-nitro-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2c3ccc([N+](=O)[O-])cc3-c3c(ssc3=S)C2(C)C)c1 |
| InChI | InChI=1S/C20H16N2O3S3/c1-11-5-4-6-12(9-11)18(23)21-15-8-7-13(22(24)25)10-14(15)16-17(20(21,2)3)27-28-19(16)26/h4-10H,1-3H3 |
| InChIKey | SUBDQGTUZYCOEV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|