C11H19N3O4 — CID 28746252
(E)-4-[2-(diethylazaniumyl)ethylcarbamoylamino]-4-oxobut-2-enoate (PubChem CID 28746252) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is (E)-4-[2-(diethylazaniumyl)ethylcarbamoylamino]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[2-(diethylazaniumyl)ethylcarbamoylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 28746252 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (E)-4-[2-(diethylazaniumyl)ethylcarbamoylamino]-4-oxobut-2-enoate |
| SMILES | CC[NH+](CC)CCNC(=O)NC(=O)/C=C/C(=O)[O-] |
| InChI | InChI=1S/C11H19N3O4/c1-3-14(4-2)8-7-12-11(18)13-9(15)5-6-10(16)17/h5-6H,3-4,7-8H2,1-2H3,(H,16,17)(H2,12,13,15,18)/b6-5+ |
| InChIKey | SPVKDTGCPUECLF-AATRIKPKSA-N |
| XLogP | -2.96 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|