C12H12ClF8NO2 — CID 3053564
2-[3,5-bis(1,1,2,2-tetrafluoroethoxy)phenyl]ethanamine;hydrochloride (PubChem CID 3053564) has the molecular formula C12H12ClF8NO2 and a molecular weight of 389.67 g/mol. Its IUPAC name is 2-[3,5-bis(1,1,2,2-tetrafluoroethoxy)phenyl]ethanamine;hydrochloride.
| Compound Name | 2-[3,5-bis(1,1,2,2-tetrafluoroethoxy)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 3053564 |
| Molecular Formula | C12H12ClF8NO2 |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-[3,5-bis(1,1,2,2-tetrafluoroethoxy)phenyl]ethanamine;hydrochloride |
| SMILES | Cl.NCCc1cc(OC(F)(F)C(F)F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H11F8NO2.ClH/c13-9(14)11(17,18)22-7-3-6(1-2-21)4-8(5-7)23-12(19,20)10(15)16;/h3-5,9-10H,1-2,21H2;1H |
| InChIKey | LDNIOAZVDNAKCE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|