C15H15F6N5O — CID 3259684
4-N-benzyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 3259684) has the molecular formula C15H15F6N5O and a molecular weight of 395.31 g/mol. Its IUPAC name is 4-N-benzyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-benzyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3259684 |
| Molecular Formula | C15H15F6N5O |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-N-benzyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(NCc2ccccc2)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C15H15F6N5O/c1-26(2)12-23-11(22-8-9-6-4-3-5-7-9)24-13(25-12)27-10(14(16,17)18)15(19,20)21/h3-7,10H,8H2,1-2H3,(H,22,23,24,25) |
| InChIKey | MNENQDCUTYOCFB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |