C27H21N5O6 — CID 3347972
N,N'-bis(2-methylphenyl)-N-(2,4,6-trinitrophenyl)benzenecarboximidamide (PubChem CID 3347972) has the molecular formula C27H21N5O6 and a molecular weight of 511.49 g/mol. Its IUPAC name is N,N'-bis(2-methylphenyl)-N-(2,4,6-trinitrophenyl)benzenecarboximidamide.
| Compound Name | N,N'-bis(2-methylphenyl)-N-(2,4,6-trinitrophenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 3347972 |
| Molecular Formula | C27H21N5O6 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | N,N'-bis(2-methylphenyl)-N-(2,4,6-trinitrophenyl)benzenecarboximidamide |
| SMILES | Cc1ccccc1/N=C(\c1ccccc1)N(c1ccccc1C)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H21N5O6/c1-18-10-6-8-14-22(18)28-27(20-12-4-3-5-13-20)29(23-15-9-7-11-19(23)2)26-24(31(35)36)16-21(30(33)34)17-25(26)32(37)38/h3-17H,1-2H3/b28-27+ |
| InChIKey | ZUIVGENPYMCRDZ-BYYHNAKLSA-N |
| XLogP | 6.94 |
| TPSA | 145.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|