C16H13N6O5S+ — CID 3370145
5-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-(3-methylpyridin-1-ium-1-yl)-3H-1,3-thiazol-2-one (PubChem CID 3370145) has the molecular formula C16H13N6O5S+ and a molecular weight of 401.38 g/mol. Its IUPAC name is 5-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-(3-methylpyridin-1-ium-1-yl)-3H-1,3-thiazol-2-one.
| Compound Name | 5-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-(3-methylpyridin-1-ium-1-yl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 3370145 |
| Molecular Formula | C16H13N6O5S+ |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 5-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-4-(3-methylpyridin-1-ium-1-yl)-3H-1,3-thiazol-2-one |
| SMILES | Cc1ccc[n+](-c2[nH]c(=O)sc2C=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12N6O5S/c1-10-3-2-6-20(9-10)15-14(28-16(23)18-15)8-17-19-12-5-4-11(21(24)25)7-13(12)22(26)27/h2-9,19H,1H3/p+1 |
| InChIKey | QJZAVPHRUAAORY-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|