C28H33N6O3+ — CID 3501241
N-[[4-ethoxy-3-[(6-oxo-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide (PubChem CID 3501241) has the molecular formula C28H33N6O3+ and a molecular weight of 501.61 g/mol. Its IUPAC name is N-[[4-ethoxy-3-[(6-oxo-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | N-[[4-ethoxy-3-[(6-oxo-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 3501241 |
| Molecular Formula | C28H33N6O3+ |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | N-[[4-ethoxy-3-[(6-oxo-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
| SMILES | CCOc1ccc(C=NNC(=O)c2n[nH]c3c2CCC3)cc1C[NH+]1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C28H32N6O3/c1-2-37-25-10-9-18(13-29-32-28(36)27-22-5-3-6-23(22)30-31-27)11-21(25)17-33-14-19-12-20(16-33)24-7-4-8-26(35)34(24)15-19/h4,7-11,13,19-20H,2-3,5-6,12,14-17H2,1H3,(H,30,31)(H,32,36)/p+1 |
| InChIKey | OTJRJHOTGOTPSG-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|