C28H29FN4O3 — CID 46368784
N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-4-fluorobenzamide (PubChem CID 46368784) has the molecular formula C28H29FN4O3 and a molecular weight of 488.56 g/mol. Its IUPAC name is N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-4-fluorobenzamide.
| Compound Name | N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 46368784 |
| Molecular Formula | C28H29FN4O3 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-4-fluorobenzamide |
| SMILES | CCOc1ccc(/C=N/NC(=O)c2ccc(F)cc2)cc1CN1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C28H29FN4O3/c1-2-36-26-11-6-19(14-30-31-28(35)21-7-9-24(29)10-8-21)12-23(26)18-32-15-20-13-22(17-32)25-4-3-5-27(34)33(25)16-20/h3-12,14,20,22H,2,13,15-18H2,1H3,(H,31,35)/b30-14+ |
| InChIKey | VPHJKTKQHZWNBZ-AMVVHIIESA-N |
| XLogP | 3.77 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|