C28H30N4O6 — CID 46368753
N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3,4,5-trihydroxybenzamide (PubChem CID 46368753) has the molecular formula C28H30N4O6 and a molecular weight of 518.57 g/mol. Its IUPAC name is N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 46368753 |
| Molecular Formula | C28H30N4O6 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3,4,5-trihydroxybenzamide |
| SMILES | CCOc1ccc(/C=N/NC(=O)c2cc(O)c(O)c(O)c2)cc1CN1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C28H30N4O6/c1-2-38-25-7-6-17(12-29-30-28(37)19-10-23(33)27(36)24(34)11-19)8-21(25)16-31-13-18-9-20(15-31)22-4-3-5-26(35)32(22)14-18/h3-8,10-12,18,20,33-34,36H,2,9,13-16H2,1H3,(H,30,37)/b29-12+ |
| InChIKey | RXLQVLRGQUYOBB-XKJRVUDJSA-N |
| XLogP | 2.75 |
| TPSA | 136.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|