C34H38N4O4 — CID 5107608
N-[[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3-methyl-2-phenacylbut-2-enamide (PubChem CID 5107608) has the molecular formula C34H38N4O4 and a molecular weight of 566.70 g/mol. Its IUPAC name is N-[[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3-methyl-2-phenacylbut-2-enamide.
| Compound Name | N-[[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3-methyl-2-phenacylbut-2-enamide |
|---|---|
| PubChem CID | 5107608 |
| Molecular Formula | C34H38N4O4 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | N-[[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3-methyl-2-phenacylbut-2-enamide |
| SMILES | CCOc1ccc(C=NNC(=O)C(CC(=O)c2ccccc2)=C(C)C)cc1CN1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C34H38N4O4/c1-4-42-32-14-13-24(18-35-36-34(41)29(23(2)3)17-31(39)26-9-6-5-7-10-26)15-28(32)22-37-19-25-16-27(21-37)30-11-8-12-33(40)38(30)20-25/h5-15,18,25,27H,4,16-17,19-22H2,1-3H3,(H,36,41) |
| InChIKey | CIFUYGJLOCLUJF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|