C32H32ClN7O4 — CID 46368773
5-N-(4-chlorophenyl)-4-N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-1H-imidazole-4,5-dicarboxamide (PubChem CID 46368773) has the molecular formula C32H32ClN7O4 and a molecular weight of 614.11 g/mol. Its IUPAC name is 5-N-(4-chlorophenyl)-4-N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 5-N-(4-chlorophenyl)-4-N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 46368773 |
| Molecular Formula | C32H32ClN7O4 |
| Molecular Weight | 614.11 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | 5-N-(4-chlorophenyl)-4-N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-1H-imidazole-4,5-dicarboxamide |
| SMILES | CCOc1ccc(/C=N/NC(=O)c2nc[nH]c2C(=O)Nc2ccc(Cl)cc2)cc1CN1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C32H32ClN7O4/c1-2-44-27-11-6-20(12-23(27)18-39-15-21-13-22(17-39)26-4-3-5-28(41)40(26)16-21)14-36-38-32(43)30-29(34-19-35-30)31(42)37-25-9-7-24(33)8-10-25/h3-12,14,19,21-22H,2,13,15-18H2,1H3,(H,34,35)(H,37,42)(H,38,43)/b36-14+ |
| InChIKey | VDJKUAFXBFQZCR-QQMJPZKZSA-N |
| XLogP | 4.26 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.11 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|