C32H33N4O4+ — CID 5107612
N-[[4-ethoxy-3-[(6-oxo-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 5107612) has the molecular formula C32H33N4O4+ and a molecular weight of 537.64 g/mol. Its IUPAC name is N-[[4-ethoxy-3-[(6-oxo-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[[4-ethoxy-3-[(6-oxo-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5107612 |
| Molecular Formula | C32H33N4O4+ |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | N-[[4-ethoxy-3-[(6-oxo-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | CCOc1ccc(C=NNC(=O)c2cc3ccccc3cc2O)cc1C[NH+]1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C32H32N4O4/c1-2-40-30-11-10-21(16-33-34-32(39)27-14-23-6-3-4-7-24(23)15-29(27)37)12-26(30)20-35-17-22-13-25(19-35)28-8-5-9-31(38)36(28)18-22/h3-12,14-16,22,25,37H,2,13,17-20H2,1H3,(H,34,39)/p+1 |
| InChIKey | OBGFIHQVJYJBAC-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|