C25H29N7O3S — CID 3634657
N-[[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-4-(methylamino)-1,2,5-thiadiazole-3-carboxamide (PubChem CID 3634657) has the molecular formula C25H29N7O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is N-[[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-4-(methylamino)-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-[[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-4-(methylamino)-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 3634657 |
| Molecular Formula | C25H29N7O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | N-[[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]-4-(methylamino)-1,2,5-thiadiazole-3-carboxamide |
| SMILES | CCOc1ccc(C=NNC(=O)c2nsnc2NC)cc1CN1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C25H29N7O3S/c1-3-35-21-8-7-16(11-27-28-25(34)23-24(26-2)30-36-29-23)9-19(21)15-31-12-17-10-18(14-31)20-5-4-6-22(33)32(20)13-17/h4-9,11,17-18H,3,10,12-15H2,1-2H3,(H,26,30)(H,28,34) |
| InChIKey | ZOFOBYDJGMSQOM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|