C30H33N5O4 — CID 46368760
4-acetamido-N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]benzamide (PubChem CID 46368760) has the molecular formula C30H33N5O4 and a molecular weight of 527.63 g/mol. Its IUPAC name is 4-acetamido-N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]benzamide.
| Compound Name | 4-acetamido-N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 46368760 |
| Molecular Formula | C30H33N5O4 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 4-acetamido-N-[(E)-[4-ethoxy-3-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]phenyl]methylideneamino]benzamide |
| SMILES | CCOc1ccc(/C=N/NC(=O)c2ccc(NC(C)=O)cc2)cc1CN1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C30H33N5O4/c1-3-39-28-12-7-21(15-31-33-30(38)23-8-10-26(11-9-23)32-20(2)36)13-25(28)19-34-16-22-14-24(18-34)27-5-4-6-29(37)35(27)17-22/h4-13,15,22,24H,3,14,16-19H2,1-2H3,(H,32,36)(H,33,38)/b31-15+ |
| InChIKey | OJGYOXONCFCUGO-IBBHUPRXSA-N |
| XLogP | 3.59 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|