C18H28INO3 — CID 35026498
N-[(4-hydroxy-2-iodo-5-methoxyphenyl)methyl]-8-methylnonanamide (PubChem CID 35026498) has the molecular formula C18H28INO3 and a molecular weight of 433.33 g/mol. Its IUPAC name is N-[(4-hydroxy-2-iodo-5-methoxyphenyl)methyl]-8-methylnonanamide.
| Compound Name | N-[(4-hydroxy-2-iodo-5-methoxyphenyl)methyl]-8-methylnonanamide |
|---|---|
| PubChem CID | 35026498 |
| Molecular Formula | C18H28INO3 |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[(4-hydroxy-2-iodo-5-methoxyphenyl)methyl]-8-methylnonanamide |
| SMILES | COc1cc(CNC(=O)CCCCCCC(C)C)c(I)cc1O |
| InChI | InChI=1S/C18H28INO3/c1-13(2)8-6-4-5-7-9-18(22)20-12-14-10-17(23-3)16(21)11-15(14)19/h10-11,13,21H,4-9,12H2,1-3H3,(H,20,22) |
| InChIKey | WPVUDCLXIKWQHK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|