C36H46ClFN2O4 — CID 3578102
1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperidine-4-carboxamide (PubChem CID 3578102) has the molecular formula C36H46ClFN2O4 and a molecular weight of 625.23 g/mol. Its IUPAC name is 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3578102 |
| Molecular Formula | C36H46ClFN2O4 |
| Molecular Weight | 625.23 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]piperidine-4-carboxamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCC(C(N)=O)CC2)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C36H46ClFN2O4/c1-23-5-4-15-35(2)30(12-16-36(35,44)22-40-17-13-25(14-18-40)34(39)43)27-11-9-24(19-26(41)10-8-23)20-28(27)33(42)21-29-31(37)6-3-7-32(29)38/h3,5-7,9,11,20,25-26,30,41,44H,4,8,10,12-19,21-22H2,1-2H3,(H2,39,43) |
| InChIKey | QHZRQUMDJUBKJQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.23 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|