C10H9N7OS — CID 3590293
3-N-[(7-methyl-2,1,3-benzothiadiazol-4-yl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine (PubChem CID 3590293) has the molecular formula C10H9N7OS and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-N-[(7-methyl-2,1,3-benzothiadiazol-4-yl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine.
| Compound Name | 3-N-[(7-methyl-2,1,3-benzothiadiazol-4-yl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine |
|---|---|
| PubChem CID | 3590293 |
| Molecular Formula | C10H9N7OS |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3-N-[(7-methyl-2,1,3-benzothiadiazol-4-yl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine |
| SMILES | Cc1ccc(C=NNc2nonc2N)c2nsnc12 |
| InChI | InChI=1S/C10H9N7OS/c1-5-2-3-6(8-7(5)16-19-17-8)4-12-13-10-9(11)14-18-15-10/h2-4H,1H3,(H2,11,14)(H,13,15) |
| InChIKey | BSWWDNJWBMKQKK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|