C14H22N5O7P — CID 3670862
N-[diethylamino-(2,4,6-trinitrophenyl)phosphoryl]-N-ethylethanamine (PubChem CID 3670862) has the molecular formula C14H22N5O7P and a molecular weight of 403.33 g/mol. Its IUPAC name is N-[diethylamino-(2,4,6-trinitrophenyl)phosphoryl]-N-ethylethanamine.
| Compound Name | N-[diethylamino-(2,4,6-trinitrophenyl)phosphoryl]-N-ethylethanamine |
|---|---|
| PubChem CID | 3670862 |
| Molecular Formula | C14H22N5O7P |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[diethylamino-(2,4,6-trinitrophenyl)phosphoryl]-N-ethylethanamine |
| SMILES | CCN(CC)P(=O)(c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])N(CC)CC |
| InChI | InChI=1S/C14H22N5O7P/c1-5-15(6-2)27(26,16(7-3)8-4)14-12(18(22)23)9-11(17(20)21)10-13(14)19(24)25/h9-10H,5-8H2,1-4H3 |
| InChIKey | BTISBJICYOIVSA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 152.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|