C36H44N4O2S — CID 3687006
[5-methoxy-2-(1,3,5-trimethylpyrazol-4-yl)phenyl]-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]methanone (PubChem CID 3687006) has the molecular formula C36H44N4O2S and a molecular weight of 596.84 g/mol. Its IUPAC name is [5-methoxy-2-(1,3,5-trimethylpyrazol-4-yl)phenyl]-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | [5-methoxy-2-(1,3,5-trimethylpyrazol-4-yl)phenyl]-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 3687006 |
| Molecular Formula | C36H44N4O2S |
| Molecular Weight | 596.84 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | [5-methoxy-2-(1,3,5-trimethylpyrazol-4-yl)phenyl]-[4-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]methanone |
| SMILES | COc1ccc(-c2c(C)nn(C)c2C)c(C(=O)N2CCC(c3nc(-c4ccc5c(c4)C(C)(C)CCC5(C)C)cs3)CC2)c1 |
| InChI | InChI=1S/C36H44N4O2S/c1-22-32(23(2)39(7)38-22)27-11-10-26(42-8)20-28(27)34(41)40-17-13-24(14-18-40)33-37-31(21-43-33)25-9-12-29-30(19-25)36(5,6)16-15-35(29,3)4/h9-12,19-21,24H,13-18H2,1-8H3 |
| InChIKey | FFJCBTKGPDPQBD-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.84 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |