C27H26FN7O4 — CID 3807837
2-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-6-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 3807837) has the molecular formula C27H26FN7O4 and a molecular weight of 531.55 g/mol. Its IUPAC name is 2-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-6-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-6-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 3807837 |
| Molecular Formula | C27H26FN7O4 |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 2-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-6-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | O=[N+]([O-])c1c(N2CCN(Cc3ccc4c(c3)OCO4)CC2)ncnc1N1CCc2[nH]c3c(F)cccc3c2C1 |
| InChI | InChI=1S/C27H26FN7O4/c28-20-3-1-2-18-19-14-34(7-6-21(19)31-24(18)20)27-25(35(36)37)26(29-15-30-27)33-10-8-32(9-11-33)13-17-4-5-22-23(12-17)39-16-38-22/h1-5,12,15,31H,6-11,13-14,16H2 |
| InChIKey | QKTUVOQTBIKHHO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|