C39H52ClFN2O5 — CID 4062754
1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea (PubChem CID 4062754) has the molecular formula C39H52ClFN2O5 and a molecular weight of 683.31 g/mol. Its IUPAC name is 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea.
| Compound Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 4062754 |
| Molecular Formula | C39H52ClFN2O5 |
| Molecular Weight | 683.31 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC2CCCO2)C(=O)NC(C)C)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C39H52ClFN2O5/c1-25(2)42-37(46)43(23-29-9-7-19-48-29)24-39(47)18-16-33-30-15-13-27(20-28(44)14-12-26(3)8-6-17-38(33,39)4)21-31(30)36(45)22-32-34(40)10-5-11-35(32)41/h5,8,10-11,13,15,21,25,28-29,33,44,47H,6-7,9,12,14,16-20,22-24H2,1-4H3,(H,42,46) |
| InChIKey | DWJFKTPLHFQCSD-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.31 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|