C23H20N4O3S — CID 4165537
3-[3-(4-butoxyphenyl)-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one (PubChem CID 4165537) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 3-[3-(4-butoxyphenyl)-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one.
| Compound Name | 3-[3-(4-butoxyphenyl)-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one |
|---|---|
| PubChem CID | 4165537 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3-[3-(4-butoxyphenyl)-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]chromen-2-one |
| SMILES | CCCCOc1ccc(-c2nnc3n2NC(c2cc4ccccc4oc2=O)=CS3)cc1 |
| InChI | InChI=1S/C23H20N4O3S/c1-2-3-12-29-17-10-8-15(9-11-17)21-24-25-23-27(21)26-19(14-31-23)18-13-16-6-4-5-7-20(16)30-22(18)28/h4-11,13-14,26H,2-3,12H2,1H3 |
| InChIKey | JGWOMOCPOKEWBH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|