C19H11N3O3S — CID 5009297
3-(2-oxochromen-3-yl)-4H-[1,3,4]thiadiazino[2,3-b]quinazolin-6-one (PubChem CID 5009297) has the molecular formula C19H11N3O3S and a molecular weight of 361.38 g/mol. Its IUPAC name is 3-(2-oxochromen-3-yl)-4H-[1,3,4]thiadiazino[2,3-b]quinazolin-6-one.
| Compound Name | 3-(2-oxochromen-3-yl)-4H-[1,3,4]thiadiazino[2,3-b]quinazolin-6-one |
|---|---|
| PubChem CID | 5009297 |
| Molecular Formula | C19H11N3O3S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 3-(2-oxochromen-3-yl)-4H-[1,3,4]thiadiazino[2,3-b]quinazolin-6-one |
| SMILES | O=c1oc2ccccc2cc1C1=CSc2nc3ccccc3c(=O)n2N1 |
| InChI | InChI=1S/C19H11N3O3S/c23-17-12-6-2-3-7-14(12)20-19-22(17)21-15(10-26-19)13-9-11-5-1-4-8-16(11)25-18(13)24/h1-10,21H |
| InChIKey | WOIKWXMIPQLQFJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|