C18H11N6O8S- — CID 4177896
4-[[4-(2,4-dinitro-N-nitrosoanilino)phenyl]diazenyl]benzenesulfonate (PubChem CID 4177896) has the molecular formula C18H11N6O8S- and a molecular weight of 471.39 g/mol. Its IUPAC name is 4-[[4-(2,4-dinitro-N-nitrosoanilino)phenyl]diazenyl]benzenesulfonate.
| Compound Name | 4-[[4-(2,4-dinitro-N-nitrosoanilino)phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 4177896 |
| Molecular Formula | C18H11N6O8S- |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 4-[[4-(2,4-dinitro-N-nitrosoanilino)phenyl]diazenyl]benzenesulfonate |
| SMILES | O=NN(c1ccc(/N=N/c2ccc(S(=O)(=O)[O-])cc2)cc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12N6O8S/c25-21-22(17-10-7-15(23(26)27)11-18(17)24(28)29)14-5-1-12(2-6-14)19-20-13-3-8-16(9-4-13)33(30,31)32/h1-11H,(H,30,31,32)/p-1/b20-19+ |
| InChIKey | GDVSHVJLNRUGJA-FMQUCBEESA-M |
| XLogP | 4.64 |
| TPSA | 200.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|