C24H41N2O+ — CID 4225746
2,6-ditert-butyl-4-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]phenol (PubChem CID 4225746) has the molecular formula C24H41N2O+ and a molecular weight of 373.61 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 4225746 |
| Molecular Formula | C24H41N2O+ |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.32 |
| IUPAC Name | 2,6-ditert-butyl-4-[(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)iminomethyl]phenol |
| SMILES | CC1(C)CC(/N=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C24H40N2O/c1-21(2,3)18-11-16(12-19(20(18)27)22(4,5)6)15-25-17-13-23(7,8)26-24(9,10)14-17/h11-12,15,17,26-27H,13-14H2,1-10H3/p+1/b25-15+ |
| InChIKey | HEZWFYAINFDAFR-MFKUBSTISA-O |
| XLogP | 4.69 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|